This compound is a research reagent with a complex heterocyclic structure incorporating halogen atoms and a difluoromethoxy group. It is primarily of interest for laboratory-scale studies and chemical research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 3039517-14-8
2-Piperidinoethanol
Research compound for synthetic chemistry
D-Arabinoic acid sodium salt
sodium salt of arabinoic acid
3-Aminophenylboronic acid
research compound
8-Methyl-7H-purin-6-ol
research compound
(1R,3R)-1-[2-bromo-6-(difluoromethoxy)phenyl]-7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-3-amine
Research compound
(1R)-1-[2-bromo-6-(difluoromethoxy)phenyl]-7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-3-amine
RWHDLZYBIPZZOG-JLOHTSLTSA-N
C1[C@@H](N2C3=C(C=CC(=C3)Cl)N=C2C1N)C4=C(C=CC=C4Br)OC(F)F
—