GHK-Cu acetate is a salt form of the copper peptide GHK-Cu, characterized by a copper(II) ion coordinated to a modified tripeptide ligand with an acetate counterion. It is commonly used as a research compound in laboratory settings for studying cellular processes and peptide-metal interactions.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 300801-03-0
5-formylindan
research chemical building block
8-{[(tert-butoxy)carbonyl]amino}octanoic acid
protected amino acid building block
5-Fluoro-1,3-dimethyluracil
research compound
1-Acetyl-2-pyrrolidinecarboxamide
research compound
copper;acetic acid;(2S)-6-amino-2-[[(2S)-2-(2-aminoacetyl)azanidyl-3-(1H-imidazol-4-yl)propanoyl]amino]hexanoate
NOIHSRSQDMJJFH-ULEGLUPFSA-L
CC(=O)O.C1=C(N=CN1)C[C@@H](C(=O)N[C@@H](CCCCN)C(=O)[O-])[N-]C(=O)CN.[Cu+2]