Polyglyceryl-10 polyricinoleate is a food additive used primarily as an emulsifier. It is a complex molecule composed of a polyglycerol backbone esterified with ricinoleic acid, featuring multiple hydroxyl and ether groups that contribute to its hydrophilic-lipophilic balance.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 29894-35-7
[3-[3-(2,3-dihydroxypropoxy)-2-hydroxypropoxy]-2-hydroxypropyl] 12-hydroxyoctadec-9-enoate
HUXYPHWJPJYMBC-UHFFFAOYSA-N
CCCCCCC(CC=CCCCCCCCC(=O)OCC(COCC(COCC(CO)O)O)O)O
—