2,3-Dichlorophenoxyacetic acid is a chlorinated phenoxy herbicide, structurally related to auxin-type herbicides. It is an organic compound characterized by an aromatic ring and carboxylic acid functional group.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2976-74-1
2-(2,3-dichlorophenoxy)acetic acid
RBJIGQRZLITQJG-UHFFFAOYSA-N
C1=CC(=C(C(=C1)Cl)Cl)OCC(=O)O