Butanedioic acid, dodecenyl- is an industrial chemical used primarily as a surfactant intermediate and corrosion inhibitor. Structurally, it is a dicarboxylic acid with a long hydrocarbon chain, which contributes to its amphiphilic properties.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 29658-97-7
Methyl 4-(trifluoromethyl)benzoate
chemical intermediate
Methyl 5-bromopyridine-3-carboxylate
Chemical intermediate for synthesis
Bis(2-ethylhexyl) hydrogen phosphate
metal extractant and lubricant additive
2-Propanol, 1-(1-methyl-2-propoxyethoxy)-
Industrial solvent for cleaning and coatings
2-[(E)-dodec-1-enyl]butanedioic acid
QDCPNGVVOWVKJG-VAWYXSNFSA-N
CCCCCCCCCC/C=C/C(CC(=O)O)C(=O)O