7-Bromo-5-chloro-1H-indole is a halogenated indole derivative with a bicyclic structure, consisting of a benzene ring fused to a pyrrole ring. It is a synthetic compound used primarily as a research reagent in chemical and pharmaceutical laboratories.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 292636-08-9
7-bromo-5-chloro-1H-indole
CBQDZTGRYHTJRO-UHFFFAOYSA-N
C1=CNC2=C(C=C(C=C21)Cl)Br