3,5-Dichlorobenzoyl chloride is a chemical compound used as an intermediate in the synthesis of pharmaceutical intermediates. It features a benzene ring with three halogen substituents and a reactive acyl chloride group.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2905-62-6
3-Pyridinecarboxamide, 1-ethyl-1,2-dihydro-6-hydroxy-4-methyl-2-oxo-
Pharmaceutical intermediate
N-(2-Oxoethyl)phthalimide
Pharmaceutical intermediate for cyclopyrrolone drugs
(2S)-but-3-yn-2-ol
Chiral building block for synthesis
Fmoc-L-Lys[C20-OtBu-L-Glu(OtBu)-AA-AA]-OH
Pharmaceutical intermediate for peptide synthesis
3,5-dichlorobenzoyl chloride
GGHLXLVPNZMBQR-UHFFFAOYSA-N
C1=C(C=C(C=C1Cl)Cl)C(=O)Cl