9-Fluorenylmethyl chloroformate (Fmoc-Cl) is a chloroformate ester widely employed as a protecting group reagent for amines. It introduces the fluorenylmethyloxycarbonyl (Fmoc) carbamate protecting group, commonly used in peptide synthesis and organic chemistry.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 28920-43-6
9H-fluoren-9-ylmethyl carbonochloridate
IRXSLJNXXZKURP-UHFFFAOYSA-N
C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)Cl