This compound is a pharmaceutical intermediate used in the synthesis of NK1 receptor antagonists such as aprepitant. It features a complex stereochemically defined structure with aromatic rings, ether linkages, and halogen substituents, making it a key building block in manufacturing processes.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 287930-75-0
Ethyl 8-(2,4-dioxo-2H-1,3-benzoxazin-3(4H)-yl)octanoate
Pharmaceutical intermediate for API synthesis
3,6-Dihydro-2H-pyran-4-boronic acid pinacol ester
boronic ester pharmaceutical intermediate
Benzyl 4-(chlorosulfonyl)piperidine-1-carboxylate
Pharmaceutical intermediate for sulfonamide synthesis
BIRG-616 BS
Impurity reference standard for nevirapine
(2R)-4-benzyl-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]morpholin-3-one
KVPJNHLVRGUYGQ-BFUOFWGJSA-N
C[C@H](C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)O[C@@H]2C(=O)N(CCO2)CC3=CC=CC=C3