(5-Fluoro-2-nitrophenyl)methanol is a chemical compound used as a pharmaceutical intermediate. It features an aromatic ring substituted with a fluorine atom and a nitro group, along with a primary alcohol functional group, making it a building block in the synthesis of more complex molecules.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 287121-32-8
Sodium 2,3,3-trimethyl-3H-indole-5-sulfonate
Pharmaceutical intermediate
Tert-butyl 4-ethynylpiperidine-1-carboxylate
pharmaceutical intermediate
4-Chloropyrido[2,3-d]pyrimidine
Pharmaceutical intermediate for drug synthesis
5-bromonicotinamide
pharmaceutical intermediate
(5-fluoro-2-nitrophenyl)methanol
CWOZQRGVHQIIJL-UHFFFAOYSA-N
C1=CC(=C(C=C1F)CO)[N+](=O)[O-]
—