2-Aminobenzophenone is a chemical compound used primarily as a pharmaceutical intermediate in drug manufacturing. It consists of an aromatic ketone structure with an amino substituent, giving it notable polarity and ring-containing character.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2835-77-0
4-Amino-2-methylphenol
Pharmaceutical intermediate
2-Chloro-N-(4-chloro-2-(2-fluorobenzoyl)phenyl)acetamide
Pharmaceutical intermediate for synthesis
5-amino-2-methylbenzoic acid
Pharmaceutical intermediate compound
3-Amino-4-methoxybenzoic acid
pharmaceutical intermediate
(2-aminophenyl)-phenylmethanone
MAOBFOXLCJIFLV-UHFFFAOYSA-N
C1=CC=C(C=C1)C(=O)C2=CC=CC=C2N