Garcinia lactone is a chemical compound structurally characterized as a polysubstituted lactone ring bearing carboxylic acid and alcohol functional groups, which is associated with the plant genus Garcinia. It is commonly supplied as a certified reference standard for analytical research and quality control applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 27750-13-6
(2S,3S)-3-hydroxy-5-oxooxolane-2,3-dicarboxylic acid
PFHZIWAVXDSFTB-CVYQJGLWSA-N
C1C(=O)O[C@@H]([C@@]1(C(=O)O)O)C(=O)O