H-AEEA-AEEA-AEEA is a highly flexible, water-soluble linker compound with multiple ether groups, two amide bonds, and terminal amine and carboxylic acid groups. It is primarily used as a research reagent in linker chemistry for constructing bioconjugates or functionalized molecules.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2773558-06-6
Semaglutide impurity 50
Semaglutide process impurity or intermediate
2-[2-[2-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetic acid
pharmaceutical intermediate
Ethyl 4-(phenylmethoxy)-1H-indole-2-carboxylate
research compound
9-(2-bromophenyl-3,4,5,6-d4)-9H-carbazole-1,2,3,4,5,6,7,8-d8
deuterated research compound
(2-(9H-carbazol-9-yl-d8)phenyl-3,4,5,6-d4)boronic acid
deuterated research compound
9H-3,9'-bicarbazole-1,1',2,2',3',4,4',5,5',6,6',7,7',8,8'-d15
deuterated research compound
2-[2-[2-[[2-[2-[2-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetyl]amino]ethoxy]ethoxy]acetic acid
DLDHTLVGQUKJDC-UHFFFAOYSA-N
C(COCCOCC(=O)NCCOCCOCC(=O)NCCOCCOCC(=O)O)N