This compound is a deuterium-labeled derivative of 3-bromo-9H-carbazole, used primarily as a research reagent in chemical and biochemical studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2764814-81-3
(1S)-2,2,2-trifluoro-1-methylethyl]hydrazine hydrochloride
research compound
(4-chlorophenyl)(pyridin-2-yl)methanol
research compound
[4-(1,3,4-oxadiazol-2-yl)phenyl]boronic Acid
research compound
1,5-Bis(diphenylphosphino)pentane
organophosphorus ligand for coordination chemistry
3-Bromocarbazole
research compound
3-bromo-1,2,4,5,6,7,8-heptadeuterio-9H-carbazole
LTBWKAYPXIIVPC-GSNKEKJESA-N
[2H]C1=C(C(=C2C(=C1[2H])C3=C(N2)C(=C(C(=C3[2H])Br)[2H])[2H])[2H])[2H]
—