1,2,4,5-Cyclohexanetetracarboxylic dianhydride is a bicyclic anhydride compound primarily used as a monomer in the synthesis of polyimide polymers, which are valued for their thermal stability and mechanical properties.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2754-41-8
3-Oxabicyclo[3.1.0]hexane-2,4-dione
chemical intermediate in organic synthesis
3,3',4,4'-Biphenyltetracarboxylic dianhydride
monomer for polyimide synthesis
[4,5'-Biisobenzofuran]-1,1',3,3'-tetrone
monomer for polyimide synthesis
1,3-Bis(4-aminophenoxy)benzene
monomer for polyimide synthesis
Diisooctyl phthalate
Plasticizer for PVC and resins
1h,1h,2h,2h-perfluorooctanesulfonic acid
surfactant for industrial applications
5-Isoquinolinesulfonic acid
sulfonic acid intermediate
Butane-1,4-disulfonic acid
Industrial sulfonic acid reagent
3a,4,4a,7a,8,8a-hexahydrofuro[3,4-f][2]benzofuran-1,3,5,7-tetrone
LJMPOXUWPWEILS-UHFFFAOYSA-N
C1C2C(CC3C1C(=O)OC3=O)C(=O)OC2=O