Hydroxy dicyclopentadiene is a tricyclic alcohol compound used as an intermediate in pharmaceutical manufacturing. Its structure features a hydroxyl group attached to a tricyclodecene framework, and it is primarily supplied for research and production purposes.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 27137-33-3
Ethyl (2Z)-2-chloro-2-[2-(4-methoxyphenyl)hydrazinylidene]acetate
pharmaceutical intermediate
3-Pyridazinecarboxylic acid, 6-chloro-4-[[2-methoxy-3-(1-methyl-1H-1,2,4-triazol-3-yl)phenyl]amino]-, methyl ester
pharmaceutical intermediate
5-{[(tert-butoxy)carbonyl]amino}pentanoic acid
pharmaceutical intermediate
3-(1-PIPERAZINYL)PROPIONIC ACID
pharmaceutical intermediate
(1S,2R,7R)-tricyclo[5.2.1.02,6]dec-4-en-3-ol
HRWRJUVJOLBMST-DJAYFPKFSA-N
C1C[C@@H]2C[C@H]1[C@@H]3C2C=CC3O