[Hydroxy(tosyloxy)iodo]benzene is a hypervalent iodine compound that serves as an oxidizing reagent in organic synthesis. It is characterized by its aromatic rings and a single iodine atom in a hypervalent state, with a molecular weight of approximately 392 g/mol and moderate lipophilicity.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 27126-76-7
1-Acetoxy-1,2-benziodoxol-3-one
hypervalent iodine oxidizing reagent
[Bis(trifluoroacetoxy)iodo]benzene
hypervalent iodine oxidizing reagent
3,5-Difluorophenol
Research compound for crystallography studies
2,3-Difluorofumaric acid
research compound
3-[(triphenylmethyl)sulfanyl]propanoic acid
Research reagent for peptide synthesis
FURO[2,3-B]PYRIDINE
research compound
[hydroxy(phenyl)-lambda3-iodanyl] 4-methylbenzenesulfonate
LRIUKPUCKCECPT-UHFFFAOYSA-N
CC1=CC=C(C=C1)S(=O)(=O)OI(C2=CC=CC=C2)O