Methyl (2R)-2-hydroxy-3-phenylpropanoate is a chemical compound used as a pharmaceutical intermediate. It contains an ester, an alcohol, and an aromatic ring, with a single chiral center.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 27000-00-6
4-Methylbenzene-1-sulfonic acid--benzyl beta-alaninate (1/1)
peptide coupling reagent intermediate
Methyl (S)-3-amino-3-(2-chloropyridin-4-yl)propanoate dihydrochloride
Pharmaceutical intermediate
2-Amino-6-chloro-3-nitropyridine
Pharmaceutical intermediate
4-chloro-2-(furan-2-ylmethyl(nitroso)amino)-5-sulfamoylbenzoic acid
Nitrosamine impurity standard
(S)-methyl 2-hydroxy-3-phenylpropanoate
n.a
methyl (2R)-2-hydroxy-3-phenylpropanoate
NMPPJJIBQQCOOI-SECBINFHSA-N
COC(=O)[C@@H](CC1=CC=CC=C1)O