This compound is a fluorinated heterocyclic research reagent featuring a fused furo-chromenone core with stereochemically defined methyl and trifluoromethyl substituents. Its structure includes multiple aromatic rings and halogen atoms, contributing to its potential utility in chemical biology and medicinal chemistry studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2649470-79-9
Propyltrimethylammonium bromide
Phase transfer catalyst
Carbonotrithioic acid, bis(phenylmethyl) ester
research compound for RAFT polymerization
(R)-2-(tert-Butyl-dimethyl-silanyloxy)-propan-1-ol
research reagent
2,3-Dihydroxy-N~1~,N~1~,N~4~,N~4~-tetramethylbutanediamide
reference standard for research
(1S,2R)-6,7-difluoro-1,2-dimethyl-2-(trifluoromethyl)-1H-furo[2,3-c]chromen-4-one
HVWSPQLRNJXDCB-VPROBKIXSA-N
C[C@H]1C2=C(C(=O)OC3=C2C=CC(=C3F)F)O[C@@]1(C)C(F)(F)F
—