N-Nitroso-Folic Acid is a nitrosamine derivative of folic acid, primarily used as a reference standard for the detection and quantification of nitrosamine impurities in pharmaceutical manufacturing. This compound features a complex polycyclic structure incorporating multiple aromatic rings and polar functional groups, reflecting its role as a specialized analytical marker.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 26360-21-4
5-Desethoxy,-5-Methoxy-Finerenone
Mineralocorticoid receptor antagonist intermediate
1-(3,4-Dihydroxyphenyl)-2-(methylamino)ethane-1-sulfonic acid
active pharmaceutical ingredient
Acalabrutinib maleate monohydrate
active pharmaceutical ingredient
Sodium chenodeoxycholate
pharmaceutical active ingredient
Folic acid
Vitamin nutritional factor
Folic acid dihydrate
active pharmaceutical ingredient
N-Nitrosofolic acid
nitrosamine impurity standard for folic acid
N2-(4-(((2-Amino-4-oxo-4,8-dihydropteridin-6-yl)methyl)amino)benzoyl)-N5-(2-(2-(2-azidoethoxy)ethoxy)ethyl)-L-glutamine
PEGylated folate probe for click chemistry
(2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-nitrosoamino]benzoyl]amino]pentanedioic acid
QPWWRIJXAKSKLU-LBPRGKRZSA-N
C1=CC(=CC=C1C(=O)N[C@@H](CCC(=O)O)C(=O)O)N(CC2=CN=C3C(=N2)C(=O)NC(=N3)N)N=O