2,4-Dichloronicotinic acid is a chemical compound commonly used as a pharmaceutical intermediate, particularly in the synthesis of active pharmaceutical ingredients. Its structure features a pyridine ring with two chlorine substituents and a carboxylic acid group.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 262423-77-8
(2S)-1-[(tert-butoxy)carbonyl]piperidine-2-carboxylic acid
Pharmaceutical intermediate for peptide synthesis
(S)-(-)-1-Phenylethylamine
Chiral resolution intermediate
3-Iodooxetane
pharmaceutical intermediate
(2S)-1-amino-1-oxo-3-((3S)-2-oxopyrrolidin-3-yl)propan-2-aminium chloride
pharmaceutical intermediate
2,4-dichloropyridine-3-carboxylic acid
ZFGZNVSNOJPGDV-UHFFFAOYSA-N
C1=CN=C(C(=C1Cl)C(=O)O)Cl