Phenoxathiin is a sulfur- and oxygen-containing heterocyclic compound with a molecular weight of approximately 200 g/mol. It is primarily employed as a research compound for the study of organic phosphorescence.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 262-20-4
(4-methoxyphenyl)(2-methyl-1h-indol-3-yl)methanone
research compound
Methyl 6-bromopyridine-2-carboxylate
research chemical
Methyl 6-methoxypyridine-3-carboxylate
Research compound for nicotinic receptor studies
Allylmagnesium chloride
Grignard reagent for introducing allyl group
phenoxathiine
GJSGGHOYGKMUPT-UHFFFAOYSA-N
C1=CC=C2C(=C1)OC3=CC=CC=C3S2