This compound is an azo compound used as a polymerization initiator in industrial chemical processes. It features two ester and two ether functional groups, contributing to its role in initiating free-radical polymerizations.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2589-57-3
Tert-butyl 2-ethylhexaneperoxoate
polymerization initiator
Tert-Butyl peroxypivalate
polymerization initiator
Peroxydicarbonic acid, bis(2-ethylhexyl) ester
polymerization initiator
1,1-Bis(tert-butylperoxy)-3,3,5-trimethylcyclohexane
polymerization initiator
2-Pentenenitrile, (Z)-
chemical intermediate
2-(2H-Benzotriazol-2-yl)-4,6-ditertpentylphenol
UV absorber for plastics
Gamma-Glycidoxypropyltriethoxysilane
silane coupling agent
Hydrochloric acid
acid cleaning and metal processing
methyl 2-[(1-methoxy-2-methyl-1-oxopropan-2-yl)diazenyl]-2-methylpropanoate
ZQMHJBXHRFJKOT-UHFFFAOYSA-N
CC(C)(C(=O)OC)N=NC(C)(C)C(=O)OC