N-Methylphenylalanine is a phenylalanine derivative with a methyl group attached to the alpha-amino function. It is primarily utilized as a research compound in laboratory settings.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2566-30-5
5'-O-(L-tyrosylsulfamoyl)adenosine
research compound
4,4,5,5-Tetramethyl-2-(naphthalen-2-yl)-1,3,2-dioxaborolane
boronic ester for cross-coupling reactions
(5-chloro-2-fluoro-3-pyridyl)-pentafluoro-sulfane
research reagent
2-Bromoethylamine hydrobromide
research compound
(2S)-2-(methylamino)-3-phenylpropanoic acid
SCIFESDRCALIIM-VIFPVBQESA-N
CN[C@@H](CC1=CC=CC=C1)C(=O)O