3-Carboxyphenylboronic acid is a boronic acid derivative containing a carboxylic acid group and an aromatic ring. It is primarily used as a research reagent and intermediate in organic synthesis, particularly for building boron-containing compounds.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 25487-66-5
3-boronobenzoic acid
DBVFWZMQJQMJCB-UHFFFAOYSA-N
B(C1=CC(=CC=C1)C(=O)O)(O)O