3-(Trimethoxysilyl)propyl methacrylate is a silane coupling agent commonly used to improve adhesion between organic polymers and inorganic substrates. Its molecular structure combines a methacrylate group for polymer bonding with trimethoxysilyl groups for surface attachment, making it valuable in adhesive formulations.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2530-85-0
3-Chloropropyltrimethoxysilane
Coupling agent for filled composites
Sodium O-isobutyl dithiocarbonate
flotation collector agent
Benzyltributylammonium bromide
Phase transfer catalyst
بولي إيثيلين جلايكول
polymer and surfactant raw material
3-trimethoxysilylpropyl 2-methylprop-2-enoate
XDLMVUHYZWKMMD-UHFFFAOYSA-N
CC(=C)C(=O)OCCC[Si](OC)(OC)OC