4-((2-Sulfatoethyl)sulfonyl)aniline is a chemical compound used as a dye intermediate, particularly in the production of reactive dyes. It is characterized by its sulfonate ester group and aromatic amine structure, contributing to its role in dye synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2494-89-5
Hansa yellow
Organic pigment for paints and inks
4-Hydroxy-6-(3-sulphoanilino)naphthalene-2-sulphonic acid
Dye intermediate
Kodak CD-3
Photographic color developer
5-Chloro-2-nitrodiphenylamine
disperse dye
2-(4-aminophenyl)sulfonylethyl hydrogen sulfate
IALORYHODRVWKZ-UHFFFAOYSA-N
C1=CC(=CC=C1N)S(=O)(=O)CCOS(=O)(=O)O