This compound is a hydrochloride salt of S-tert-butyl-L-cysteine, a derivative of the amino acid cysteine. It is primarily used as a research reagent in laboratory settings, particularly in studies involving modified amino acids for peptide synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2481-09-6
Trimethyl orthopropionate
chemical reagent and intermediate
FMOC-PRO-THR(PSI(ME,ME)PRO)-OH
research compound for peptide synthesis
(2S)-2,6-Bis({[(Tert-Butoxy)Carbonyl]Amino})Hexanoic Acid
protected lysine derivative for peptide synthesis
D-Allothreonine
D-alpha-amino acid standard
(2R)-2-amino-3-tert-butylsulfanylpropanoic acid;hydrochloride
MHBMYFJKEBCMDR-JEDNCBNOSA-N
CC(C)(C)SC[C@@H](C(=O)O)N.Cl