N-Benzoyl-4-piperidone is a chemical compound used as a pharmaceutical intermediate. It is structurally characterized by a piperidone ring with a benzoyl substituent, serving as a building block in the synthesis of various active pharmaceutical ingredients.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 24686-78-0
(S)-tert-butyl 4-Azido-3,3-difluoropiperidine-1-carboxylate
Pharmaceutical intermediate
Tert-butyl 4-fluoro-3,3-dihydroxypyrrolidine-1-carboxylate
pharmaceutical intermediate
(R)-1-Benzyl-4,4-difluoropyrrolidin-3-amine
Pharmaceutical intermediate
1-(3,3-Difluoro-4-hydroxypyrrolidin-1-yl)ethanone
pharmaceutical intermediate
1-benzoylpiperidin-4-one
NZAXGZYPZGEVBD-UHFFFAOYSA-N
C1CN(CCC1=O)C(=O)C2=CC=CC=C2