9H-Pyrido[2,3-b]indole is a research compound classified by the International Agency for Research on Cancer (IARC) as possibly carcinogenic to humans (Group 2B), based on limited evidence in humans and sufficient evidence in experimental animals. It is a tricyclic heterocyclic compound used primarily as a laboratory reagent.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 244-76-8
(2-bromophenyl)boronic Acid
research reagent for organic synthesis
5-Chloro-2-iodopyridine
research compound
Di-tert-butyl dicarbonate
Reagent for amine Boc protection
4,4'-Bi-1,3-benzodioxole-5,5'-diylbis(diphenylphosphine)
chiral ligand for asymmetric catalysis
9H-pyrido[2,3-b]indole
BPMFPOGUJAAYHL-UHFFFAOYSA-N
C1=CC=C2C(=C1)C3=C(N2)N=CC=C3