3,3',5,5'-Tetramethylbiphenyl-4,4'-diol is an organic compound that functions as an antioxidant or polymer stabilizer. Its structure features two aromatic rings with hydroxyl groups, contributing to its stabilizing properties.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2417-04-1
3,3',4,4'-Biphenyltetracarboxylic dianhydride
monomer for polyimide synthesis
3,3',4,4'-Benzophenonetetracarboxylic dianhydride
curing agent for epoxy resins
Benzene, 1,1',1''-methylidynetris[4-isocyanato-
polyurethane crosslinking agent
1,5-dibromo-2,4-dinitrobenzene
Chemical intermediate for synthesis
4-(4-hydroxy-3,5-dimethylphenyl)-2,6-dimethylphenol
YGYPMFPGZQPETF-UHFFFAOYSA-N
CC1=CC(=CC(=C1O)C)C2=CC(=C(C(=C2)C)O)C