Ifosfamide impurity B is a chemical compound used as a pharmaceutical intermediate. It is a polar, flexible molecule containing amine and halogen functional groups, and is relevant to the manufacturing of pharmaceutical compounds.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 241482-18-8
1H-Imidazole-1-ethanol, alpha-(2,4-dichlorophenyl)-
pharmaceutical intermediate
Tert-butyl (4s)-4-amino-3,3-difluoropiperidine-1-carboxylate
pharmaceutical intermediate
6,6-Dibromopenicillanic acid
Penicillin intermediate for antibiotic synthesis
Tert-Butyl (S)-(1-(3-(3-chloro-4-cyanophenyl)-1H-pyrazol-1-yl)propan-2-yl)carbamate
Pharmaceutical intermediate
[3-(2-chloroethylamino)propoxy-hydroxyphosphoryl] 3-(2-chloroethylamino)propyl hydrogen phosphate
MXHIKWVFLYAVGY-UHFFFAOYSA-N
C(CNCCCl)COP(=O)(O)OP(=O)(O)OCCCNCCCl