Methyl cis-icos-11-enoate is a long-chain fatty acid ester commonly used as a biochemical research reagent. Its structure features an ester group and one carbon-carbon double bond with cis configuration, contributing to its flexible molecular properties.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2390-09-2
Methyl laurate
flavoring agent and intermediate
Thioflavin T
fluorescent dye for amyloid detection
2-(bromomethyl)-1-fluoro-3-(trifluoromethyl)benzene
research compound for organic synthesis
(S)-ALPHA-METHYLCYSTEINE
research compound
Diethylenetriaminepentaacetic dianhydride
Chemical synthesis intermediate
methyl (E)-icos-11-enoate
RBKMRGOHCLRTLZ-ZHACJKMWSA-N
CCCCCCCC/C=C/CCCCCCCCCC(=O)OC