2-Phenyl-9H-carbazole-d5 is a deuterated derivative of 2-phenyl-9H-carbazole, where the hydrogen atoms on the phenyl ring are replaced with deuterium. It is primarily used as an isotopic internal standard or reference standard in analytical research, particularly in mass spectrometry and chromatography.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2375066-12-7
4-Hydroxybenzaldehyde-2,3,5,6-d4
deuterated reference standard for research
(2H5)Glycine
deuterated reference standard for research
Methyl 2-(2-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-oxoacetate
research compound
4-(Chlorodifluoromethyl)-2-fluoropyridine
research compound
Azido-PEG24-NHS ester
PEGylated bioconjugation reagent
(S)-1-Benzyl-3,3-difluoropiperidin-4-ol
research compound
2-(2,3,4,5,6-pentadeuteriophenyl)-9H-carbazole
IMLDYQBWZHPGJA-FSTBWYLISA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])C2=CC3=C(C=C2)C4=CC=CC=C4N3)[2H])[2H]