1H-Purine-6-carboxylic acid is a research compound structurally related to purine derivatives. It features an aromatic heterocyclic ring system with a carboxylic acid group and is primarily used in laboratory and supply contexts as a research reagent.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2365-43-7
Propanoic acid, 2-fluoro-, methyl ester
Research reagent for organic synthesis
Phenylzinc iodide
cross-coupling reagent
9-bromo-10-phenyl-anthracene
research compound
6-Chloropyrazine-2-carboxylic acid
research compound
7H-purine-6-carboxylic acid
CIEQXUBLKKQRIS-UHFFFAOYSA-N
C1=NC2=NC=NC(=C2N1)C(=O)O