This compound is a sulfino-substituted derivative of D-valine, characterized by the presence of a sulfinic acid group attached to the amino acid backbone. It is primarily used as a research reagent and chemical intermediate in laboratory and pharmaceutical manufacturing settings.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 23315-18-6
(2S)-2-amino-3-methyl-3-sulfinobutanoic acid
SVIZNTHNFAOGAB-VKHMYHEASA-N
CC(C)([C@H](C(=O)O)N)S(=O)O