This compound is an industrial chemical primarily used as a processing aid in manufacturing operations. It features a complex aromatic structure with sulfonamide and carbamate functional groups, contributing to its role in industrial applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 232938-43-1
2-Propanol, 1,3-bis((3-methyl-2-buten-1-yl)oxy)-
intermediate for chemical synthesis
Methyl 2-bromo-2-methylpropanoate
Chemical intermediate for synthesis
Methyl 2-fluoroacrylate
Monomer for polymer synthesis
2-(4-bromophenyl)-4,6-diphenyl-1,3,5-triazine
Electronic material intermediate
[3-[(4-methylphenyl)sulfonylcarbamoylamino]phenyl] 4-methylbenzenesulfonate
HEVGMYPGMWZOBU-UHFFFAOYSA-N
CC1=CC=C(C=C1)S(=O)(=O)NC(=O)NC2=CC(=CC=C2)OS(=O)(=O)C3=CC=C(C=C3)C