1,7-Phenanthroline is a research compound with a tricyclic aromatic structure containing two nitrogen atoms. It is primarily used as a laboratory reagent for chemical synthesis and coordination chemistry studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 230-46-6
MPTP hydrochloride
research compound
(1A-methyl-6-oxo-3-phenoxy-1,1a,6,6a-tetrahydroindeno[1,2-b]azirine-6a-carbonyl)glycine
research compound
Bis[(-)-pinanediolato]diboron
borylation reagent for organic synthesis
Bis(hexylene glycolato)diboron
boron reagent for organic synthesis
1,7-phenanthroline
OZKOMUDCMCEDTM-UHFFFAOYSA-N
C1=CC2=C(C3=C(C=C2)N=CC=C3)N=C1