2-Bromo-5-methoxybenzoic acid is a brominated aromatic carboxylic acid used as a pharmaceutical intermediate. Its structure features a benzoic acid core with a bromine atom at the 2-position and a methoxy group at the 5-position, making it a versatile building block for organic synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 22921-68-2
2-bromo-4-methoxybenzoic acid
research compound
4-Tritylaniline
Pharmaceutical intermediate for synthesis
2,4-THIAZOLIDINEDIONE
Pharmaceutical intermediate and research compound
(3aR,4R,6S,6aS)-Methyl 4-((tert-butoxycarbonyl)amino)-3-(pentan-3-yl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d]isoxazole-6-carboxylate
Pharmaceutical intermediate for Peramivir
(1S,4R)-1-methyl-4-(prop-1-en-2-yl)cyclohex-2-en-1-ol
Lisdexamfetamine intermediate
2-bromo-5-methoxybenzoic acid
ODHJOROUCITYNF-UHFFFAOYSA-N
COC1=CC(=C(C=C1)Br)C(=O)O