Taltobulin is a small molecule active pharmaceutical ingredient. It is a synthetic analog of the tripeptide hemiasterlin and has a monoisotopic molecular weight of 473.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 228266-40-8
Miconazole nitrate
antifungal active pharmaceutical ingredient
Lenacapavir sodium
active pharmaceutical ingredient
Anisomycin
antibiotic protein synthesis inhibitor
5-{2-oxo-hexahydro-1H-thieno[3,4-d]imidazolidin-4-yl}pentanoic acid
active pharmaceutical ingredient
(E,4S)-4-[[(2S)-3,3-dimethyl-2-[[(2S)-3-methyl-2-(methylamino)-3-phenylbutanoyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid
CNTMOLDWXSVYKD-PSRNMDMQSA-N
CC(C)[C@@H](/C=C(\C)/C(=O)O)N(C)C(=O)[C@H](C(C)(C)C)NC(=O)[C@H](C(C)(C)C1=CC=CC=C1)NC