2-Naphthoyl chloride is a chemical compound used as an intermediate in the synthesis of active pharmaceutical ingredients (APIs). It features an aromatic, naphthalene-based structure with a reactive acyl chloride group.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2243-83-6
CIS-4-(TERT-BUTOXYCARBONYLAMINO)CYCLOHEXANOL
pharmaceutical intermediate
Ethyl 4-amino-2,2-difluorobutanoate hydrochloride
pharmaceutical intermediate for API synthesis
4,6-Dichloro-pyridazine-3-carboxylic acid lithium salt monohydrate
pharmaceutical intermediate
3-Pyridazinecarboxylic acid, 6-chloro-4-[[2-methoxy-3-(1-methyl-1H-1,2,4-triazol-3-yl)phenyl]amino]-
Pharmaceutical intermediate for deucravacitinib synthesis
naphthalene-2-carbonyl chloride
XNLBCXGRQWUJLU-UHFFFAOYSA-N
C1=CC=C2C=C(C=CC2=C1)C(=O)Cl