1-Bromo-3,5-di-tert-butylbenzene is a brominated aromatic compound used as a pharmaceutical intermediate. Its structure features a benzene ring with two tert-butyl groups and one bromine substituent, making it a building block in organic synthesis for drug manufacturing.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 22385-77-9
Dimethyl methoxymethylenemalonate
Pharmaceutical intermediate
Allopurinol Impurity B
allopurinol impurity reference standard
6-FLUORO-1,2,3,4-TETRAHYDROISOQUINOLINE
pharmaceutical intermediate
Tert-butyl 2-(3-aminopropyl)-3-[tert-butyl(dimethyl)silyl]oxypiperidine-1-carboxylate
Pharmaceutical intermediate for synthesis
1-bromo-3,5-ditert-butylbenzene
BUOWTUULDKULFI-UHFFFAOYSA-N
CC(C)(C)C1=CC(=CC(=C1)Br)C(C)(C)C