S-adenosylmethioninamine is the S-adenosyl derivative of methioninamine. It acts as the aminopropyl donor in the biosynthesis of the polyamines spermidine and spermine, and is a metabolite found in organisms such as Escherichia coli, Saccharomyces cerevisiae, and humans.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 22365-13-5
Decarboxylated S-Adenosylmethionine Sulfate Salt
research compound
Methylthioadenosine sulfoxide
research compound
2,5-Cyclohexadiene-1,4-dione-2,3,5,6-d4
deuterated research compound
Mometasone Furoate EP Impurity B
Analytical reference standard impurity
(2S)-N-[(2S)-1-[4-[(6aS)-3-[3-[[(6aS)-2-methoxy-8-(4-methoxyphenyl)-11-oxo-6a,7-dihydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]propoxy]-2-methoxy-11-oxo-6a,7-dihydropyrrolo[2,1-c][1,4]benzodiazepin-8-yl]anilino]-1-oxopropan-2-yl]-2-[3-[2-[2-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]-3-methylbutanamide
antibody-drug conjugate linker payload
2-Chloro(phenyl-3,4,5,6-d4)-boronic acid
deuterated chemical research reagent
3-aminopropyl-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-methylsulfanium
ZUNBITIXDCPNSD-LSRJEVITSA-N
C[S+](CCCN)C[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C(N=CN=C32)N)O)O