This compound is a deuterated form of 4-bromotoluene, where the methyl group contains three deuterium atoms. It is primarily used as a reference standard in analytical chemistry and research applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تبحث عن شراء 4-Bromotoluene (Methyl D3)؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.
3-Bromo-1,1'-biphenyl-d9
Deuterated reference standard
1-(2-chlorophenyl)-2,3,4,5,6-pentadeuteriobenzene
Deuterated reference standard
1,2,4-TRIAZOLE-D3
Deuterated reference standard
[3-(trideuteriomethyl)phenyl]methanol
Deuterated reference standard
Propylmagnesium chloride
Grignard reagent for chemical synthesis
Tripropylphosphine
Research reagent for coordination chemistry
2-Bromopyridine-5-boronic acid
Suzuki cross-coupling reagent
(R)-(+)-alpha,alpha-Diphenyl-2-pyrrolidinemethanol
research compound
1-bromo-4-(trideuteriomethyl)benzene
ZBTMRBYMKUEVEU-FIBGUPNXSA-N
[2H]C([2H])([2H])C1=CC=C(C=C1)Br
هل تبحث عن شراء 4-Bromotoluene (Methyl D3)؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.