MAC glucuronide linker-1 is a research reagent designed as a linker compound for conjugation applications. Its structure features a glucuronide moiety with multiple acetyl groups and a fluorenylmethoxycarbonyl (Fmoc) protected amine, contributing to its high molecular weight and flexibility.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2222981-71-5
(S)-N-(4-((3-Chloro-4-fluorophenyl)amino)-7-((tetrahydrofuran-3-yl)oxy)quinazolin-6-yl)formamide (Afatinib Impurity)
research impurity reference standard
4-Ethoxyphenylboronic acid
Research intermediate for organic synthesis
7-methoxy-2,3,4,5-tetrahydro-1H-1-benzazepin-2-one
Research compound
(1H-Indol-3-yl)methanamine
Research compound
methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[[2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]acetyl]amino]-4-(2-methylsulfonylethylcarbamoyloxymethyl)phenoxy]oxane-2-carboxylate
HKCMXFVQNGHVML-KWMSUFDQSA-N
CC(=O)O[C@H]1[C@@H]([C@H](O[C@H]([C@@H]1OC(=O)C)OC2=C(C=C(C=C2)COC(=O)NCCS(=O)(=O)C)NC(=O)CN(C)C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)C(=O)OC)OC(=O)C