نابروكسين
(S)-Naproxen is the single-enantiomer active pharmaceutical ingredient of the common nonsteroidal anti-inflammatory drug naproxen. Its structure features a carboxylic acid group, an aromatic ring system, and an ether moiety, with a molecular weight of 230.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 22204-53-1
(3R,6E)-7-(2-Cyclopropyl-4-(4-fluorophenyl)-3-quinolinyl)-3-hydroxy-5-oxo-6-heptenoic acid
statin metabolite impurity
Carbimazole
antithyroid agent
(E)-N-(4-((3-Chloro-4-fluorophenyl)amino)-7-hydroxyquinazolin-6-yl)-4-(dimethylamino)but-2-enamide
active pharmaceutical ingredient
(S,E)-N-(4-((3,4-Difluorophenyl)amino)-7-((tetrahydrofuran-3-yl)oxy)quinazolin-6-yl)-4-(dimethylamino)but-2-enamide (Afatinib Impurity)
Afatinib impurity reference standard
2-(6-Methoxy-2-naphthyl)propionic acid
active pharmaceutical ingredient
Naproxen sodium
non-steroidal anti-inflammatory drug
Rac Naproxen-d3
Deuterated active pharmaceutical ingredient
(2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid
CMWTZPSULFXXJA-VIFPVBQESA-N
C[C@@H](C1=CC2=C(C=C1)C=C(C=C2)OC)C(=O)O