2-Hydroxyestradiol-d5 is a deuterium-labeled research compound, structurally related to the endogenous estrogen 2-hydroxyestradiol, used primarily in analytical and biochemical studies for tracing metabolic pathways.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 221093-33-0
2-Methoxy-17beta-estradiol-1,4,16,16,17-d5
research reagent
(8R,9S,13S,14S,17S)-16,16,17-Trideuterio-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3,4,17-triol
deuterated internal standard
2-{[(4-fluorophenyl)methyl]amino}ethan-1-ol
Research compound
5H-Pyrazolo[4,3-c]pyridine-5-carboxylic acid, 3-amino-2-(4-fluoro-3,5-dimethylphenyl)-2,4,6,7-tetrahydro-4-methyl-, 1,1-dimethylethyl ester, (4S)
research compound
(S)-5-(2,2-DIMETHYLTETRAHYDRO-2H-PYRAN-4-YL)-N-METHYL-N-PHENYL-1H-INDOLE-2-CARBOXAMIDE
research compound
(8R,9S,13S,14S,17S)-1,4,16,16,17-pentadeuterio-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-2,3,17-triol
DILDHNKDVHLEQB-MLEVBVPTSA-N
[2H]C1=C2CC[C@@H]3[C@@H](C2=C(C(=C1O)O)[2H])CC[C@]4([C@H]3CC([C@]4([2H])O)([2H])[2H])C