This compound is a chemical compound used as a pharmaceutical intermediate in the synthesis of active pharmaceutical ingredients.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2194590-02-6
(S)-3-(4-(5-Bromo-2-chlorobenzyl)phenoxy)tetrahydrofuran
research compound
(R)-3-(4-(5-bromo-2-chlorobenzyl)phenoxy)tetrahydrofuran
pharmaceutical intermediate
N-Acetyl-3,5-diiodo-l-tyrosine ethyl ester
Pharmaceutical intermediate for iodinated tyrosines
4-formyl-3-methoxybenzonitrile
pharmaceutical intermediate
N-Acetyl Guanosine
pharmaceutical intermediate
1,1-Dimethylethyl N-[(4R)-3,3-difluoro-4-piperidinyl]carbamate
Pharmaceutical intermediate for drug synthesis
(3S)-3-[4-[(2-CHLORO-5-IODOPHENYL)METHYL]PHENOXY]TETRAHYDROFURAN
n.a
(3R)-3-[4-[(2-chloro-5-iodophenyl)methyl]phenoxy]oxolane
YLUHNGIWRCCQMQ-MRXNPFEDSA-N
C1COC[C@@H]1OC2=CC=C(C=C2)CC3=C(C=CC(=C3)I)Cl