2-Bromo-5-chlorobenzoic acid is a chemical compound commonly employed as a pharmaceutical intermediate. It features a substituted benzoic acid structure with two halogen atoms, making it useful in the synthesis of active pharmaceutical ingredients.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 21739-93-5
Pregnenolone-16-ene acetate oxime
pharmaceutical intermediate for abiraterone
5-Bromo-2-iodobenzoic acid
Pharmaceutical intermediate
1-(Chloromethyl)-2-(trifluoromethyl)benzene
organic synthesis intermediate
Tert-butyl N-(azetidin-3-yl)carbamate hydrochloride
pharmaceutical intermediate for API synthesis
2-bromo-5-chlorobenzoic acid
RBCPJQQJBAQSOU-UHFFFAOYSA-N
C1=CC(=C(C=C1Cl)C(=O)O)Br