N-Hydroxy-5-norbornene-2,3-dicarboximide is a research reagent used in peptide synthesis. It features a polycyclic core containing amide functional groups and a single hydroxyl group, contributing to its reactivity in coupling reactions.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 21715-90-2
2-Amino-5-fluoropyridine
research compound
2-[Bis(2,4-di-tert-butyl-phenoxy)phosphinooxy]-3,5-di(tert-butyl)phenyl-palladium(II) chloride Dimer
organometallic catalyst for cross-coupling reactions
2-{2-[3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanamido]acetamido}acetic acid
research compound for peptide synthesis
Bis(2,5-Dioxopyrrolidin-1-yl) 4-(azidomethyl)heptanedioate
bifunctional crosslinking reagent
(Dimethylamino)((1,3-dioxo-1,3,3a,4,7,7a-hexahydro-2H-4,7-methanoisoindol-2-yl)oxy)-N,N-dimethylmethaniminium tetrafluoroborate
peptide coupling reagent for synthesis
N-(trifluoromethanesulfonyloxy)-5-norbornene-2,3-dicarboximide
chemical reagent for synthesis
4-hydroxy-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione
ZUSSTQCWRDLYJA-UHFFFAOYSA-N
C1C2C=CC1C3C2C(=O)N(C3=O)O